Difference between revisions of "Tiso gene 18283"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == * smiles: ** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7396 PWY-7396] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7396 PWY-7396] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
** InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N
+
 
* common name:
 
* common name:
−
** 4'-apo-β-carotenal
+
** butanol and isobutanol biosynthesis (engineered)
−
* molecular weight:
+
−
** 482.748   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β-apo-4'-carotenal
 
−
** 4'-apo-β,ψ-caroten-4'-al
 
−
** 4'-apo-β,ψ-carotenal
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''8''' reactions in the full pathway
−
* [[RXN-11989]]
+
* [[1.4.3.19-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Tiso_gene_13537]]
 +
*** [[Tiso_gene_16652]]
 +
*** [[Tiso_gene_11756]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-synechocystis]]
 +
* [[RXN-14986]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_2920]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-161]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-7657]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_6562]]
 +
*** [[Tiso_gene_5425]]
 +
*** [[Tiso_gene_7649]]
 +
*** [[Tiso_gene_6563]]
 +
*** [[Tiso_gene_5424]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3-ETHYLMALATE-SYNTHASE-RXN 3-ETHYLMALATE-SYNTHASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14984 RXN-14984]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14985 RXN-14985]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7643 RXN-7643]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C19892 C19892]
+
{{#set: taxonomic range=TAX-4751}}
−
* CHEBI:
+
{{#set: common name=butanol and isobutanol biosynthesis (engineered)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53157 53157]
+
{{#set: reaction found=4}}
−
* PUBCHEM:
+
{{#set: total reaction=8}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44224033 44224033]
+
{{#set: completion rate=50.0}}
−
{{#set: smiles=CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)}}
+
−
{{#set: inchi key=InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N}}
+
−
{{#set: common name=4'-apo-β-carotenal}}
+
−
{{#set: molecular weight=482.748    }}
+
−
{{#set: common name=β-apo-4'-carotenal|4'-apo-β,ψ-caroten-4'-al|4'-apo-β,ψ-carotenal}}
+
−
{{#set: produced by=RXN-11989}}
+

Revision as of 14:57, 21 March 2018

Pathway PWY-7396

  • taxonomic range:
  • common name:
    • butanol and isobutanol biosynthesis (engineered)
  • Synonym(s):

Reaction(s) found

4 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18283&oldid=31467"