Difference between revisions of "CPD-17348"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == * smiles: ** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == * smiles: ** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 4'-apo-β-carotenal |
+ | * inchi key: | ||
+ | ** InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 482.748 |
* Synonym(s): | * Synonym(s): | ||
+ | ** β-apo-4'-carotenal | ||
+ | ** 4'-apo-β,ψ-caroten-4'-al | ||
+ | ** 4'-apo-β,ψ-carotenal | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11989]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19892 C19892] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53157 53157] |
− | {{#set: smiles | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44224033 44224033] |
− | {{#set: | + | {{#set: smiles=CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)}} |
− | {{#set: molecular weight= | + | {{#set: common name=4'-apo-β-carotenal}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N}} |
− | {{#set: produced by=RXN- | + | {{#set: molecular weight=482.748 }} |
+ | {{#set: common name=β-apo-4'-carotenal|4'-apo-β,ψ-caroten-4'-al|4'-apo-β,ψ-carotenal}} | ||
+ | {{#set: produced by=RXN-11989}} |
Revision as of 14:57, 21 March 2018
Contents
Metabolite CPD-12935
- smiles:
- CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)
- common name:
- 4'-apo-β-carotenal
- inchi key:
- InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N
- molecular weight:
- 482.748
- Synonym(s):
- β-apo-4'-carotenal
- 4'-apo-β,ψ-caroten-4'-al
- 4'-apo-β,ψ-carotenal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links