Difference between revisions of "Tiso gene 4754"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * inchi key: ** InChIKey=IBGBGRVKPA...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-557 CPD-557] == * common name: ** a protein-Nω-(ADP-D-ribosyl)-L-arginine * Synonym(s...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-557 CPD-557] ==
* smiles:
+
** C(C1(C=C(C(=CC=1)O)O))=O
+
* inchi key:
+
** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 3,4-dihydroxybenzaldehyde
+
** a protein-Nω-(ADP-D-ribosyl)-L-arginine
* molecular weight:
+
** 138.123   
+
 
* Synonym(s):
 
* Synonym(s):
** protocatechualdehyde
+
** N2-(ADP-D-ribosyl)-L-arginine
** 3,4-dihydroxybenzyl aldehyde
+
** rancinamycin IV
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8872]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.4.2.31-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a protein-Nω-(ADP-D-ribosyl)-L-arginine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768]
+
{{#set: common name=N2-(ADP-D-ribosyl)-L-arginine}}
* CHEMSPIDER:
+
{{#set: reversible reaction associated=2.4.2.31-RXN}}
** [http://www.chemspider.com/Chemical-Structure.8438.html 8438]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700]
+
* HMDB : HMDB59965
+
{{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}}
+
{{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}}
+
{{#set: common name=3,4-dihydroxybenzaldehyde}}
+
{{#set: molecular weight=138.123    }}
+
{{#set: common name=protocatechualdehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}}
+
{{#set: produced by=RXN-8872}}
+

Revision as of 14:58, 21 March 2018

Metabolite CPD-557

  • common name:
    • a protein-Nω-(ADP-D-ribosyl)-L-arginine
  • Synonym(s):
    • N2-(ADP-D-ribosyl)-L-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links