Difference between revisions of "RXN1F-168"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6264 RXN-6264] == * direction: ** REVERSIBLE * common name: ** had_family_hydrolase * ec number...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6264 RXN-6264] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** had_family_hydrolase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.8.1.9 EC-3.8.1.9] |
+ | ** [http://enzyme.expasy.org/EC/3.8.1.10 EC-3.8.1.10] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * | + | ** 1 [[WATER]][c] '''+''' 1 [[R-2-Haloacids]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[Halide-Anions]][c] '''+''' 1 [[S-2-Hydroxyacids1]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 H2O[c] '''+''' 1 an (R)-2-haloacid[c] '''<=>''' 1 H+[c] '''+''' 1 a halide anion[c] '''+''' 1 an (S)-2-hydroxyacid[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[Tiso_gene_3200]] | |
− | = | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: AUTOMATED-NAME-MATCH | |
− | + | == Pathways == | |
− | + | == Reconstruction information == | |
− | + | * Category: [[annotation]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Tool: [[pathwaytools]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
− | * [[ | + | |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07308 R07308] | |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=had_family_hydrolase}} | |
− | + | {{#set: ec number=EC-3.8.1.9}} | |
− | + | {{#set: ec number=EC-3.8.1.10}} | |
− | * LIGAND- | + | {{#set: gene associated=Tiso_gene_3200}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=}} |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 14:58, 21 March 2018
Contents
Reaction RXN-6264
- direction:
- REVERSIBLE
- common name:
- had_family_hydrolase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 R-2-Haloacids[c] <=> 1 PROTON[c] + 1 Halide-Anions[c] + 1 S-2-Hydroxyacids1[c]
- With common name(s):
- 1 H2O[c] + 1 an (R)-2-haloacid[c] <=> 1 H+[c] + 1 a halide anion[c] + 1 an (S)-2-hydroxyacid[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3200
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN: