Difference between revisions of "PWY-6993"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13935 CPD-13935] == * smiles: ** C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2) * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_10738 == * right end position: ** 6551 * transcription direction: ** POSITIVE * left end position: ** 4397 * centisome position: ** 52.7471...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10738 == |
− | * | + | * right end position: |
− | ** | + | ** 6551 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 4397 |
− | * | + | * centisome position: |
− | ** | + | ** 52.74712 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ALKAPHOSPHA-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-5822]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-8748]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5491]] | ||
+ | * [[PWY-5083]] | ||
+ | * [[NADPHOS-DEPHOS-PWY]] | ||
+ | * [[NAD-BIOSYNTHESIS-II]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6551}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=4397}} | |
− | + | {{#set: centisome position=52.74712 }} | |
− | + | {{#set: reaction associated=ALKAPHOSPHA-RXN|RXN-5822|RXN-8748}} | |
− | + | {{#set: pathway associated=PWY-5491|PWY-5083|NADPHOS-DEPHOS-PWY|NAD-BIOSYNTHESIS-II}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:58, 21 March 2018
Gene Tiso_gene_10738
- right end position:
- 6551
- transcription direction:
- POSITIVE
- left end position:
- 4397
- centisome position:
- 52.74712
- Synonym(s):
Reactions associated
- Reaction: ALKAPHOSPHA-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-5822
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-8748
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation