Difference between revisions of "Tiso gene 14848"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Saturated-Fatty-Acyl-CoA Odd-Saturated-Fatty-Acyl-CoA] == * common name: ** an odd numbered...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * common name: ** aldehydo-D-ribose...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Saturated-Fatty-Acyl-CoA Odd-Saturated-Fatty-Acyl-CoA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] ==
 +
* smiles:
 +
** [CH](=O)C(O)C(O)C(O)CO
 
* common name:
 
* common name:
** an odd numbered straight chain 2,3,4-saturated fatty acyl CoA
+
** aldehydo-D-ribose
 +
* inchi key:
 +
** InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N
 +
* molecular weight:
 +
** 150.131   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-477]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-14883]]
 +
* [[RXN-14882]]
 +
* [[RXN0-5305]]
 
== External links  ==
 
== External links  ==
{{#set: common name=an odd numbered straight chain 2,3,4-saturated fatty acyl CoA}}
+
* PUBCHEM:
{{#set: produced by=RXN66-477}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5311110 5311110]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47014 47014]
 +
* METABOLIGHTS : MTBLC47014
 +
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
 +
{{#set: common name=aldehydo-D-ribose}}
 +
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N}}
 +
{{#set: molecular weight=150.131    }}
 +
{{#set: reversible reaction associated=RXN-14883|RXN-14882|RXN0-5305}}

Revision as of 14:59, 21 March 2018

Metabolite CPD-15818

  • smiles:
    • [CH](=O)C(O)C(O)C(O)CO
  • common name:
    • aldehydo-D-ribose
  • inchi key:
    • InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N
  • molecular weight:
    • 150.131
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.