Difference between revisions of "Tiso gene 14848"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Saturated-Fatty-Acyl-CoA Odd-Saturated-Fatty-Acyl-CoA] == * common name: ** an odd numbered...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * common name: ** aldehydo-D-ribose...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] == |
+ | * smiles: | ||
+ | ** [CH](=O)C(O)C(O)C(O)CO | ||
* common name: | * common name: | ||
− | ** | + | ** aldehydo-D-ribose |
+ | * inchi key: | ||
+ | ** InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N | ||
+ | * molecular weight: | ||
+ | ** 150.131 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14883]] | ||
+ | * [[RXN-14882]] | ||
+ | * [[RXN0-5305]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5311110 5311110] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47014 47014] | ||
+ | * METABOLIGHTS : MTBLC47014 | ||
+ | {{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}} | ||
+ | {{#set: common name=aldehydo-D-ribose}} | ||
+ | {{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N}} | ||
+ | {{#set: molecular weight=150.131 }} | ||
+ | {{#set: reversible reaction associated=RXN-14883|RXN-14882|RXN0-5305}} |
Revision as of 14:59, 21 March 2018
Contents
Metabolite CPD-15818
- smiles:
- [CH](=O)C(O)C(O)C(O)CO
- common name:
- aldehydo-D-ribose
- inchi key:
- InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N
- molecular weight:
- 150.131
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.