Difference between revisions of "Tiso gene 18444"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] == * smiles: ** C1(C=C(O)C(I)=CC=1OC2(=C(I)C=C(C=C(I)2)CC([N+])C(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIOTHYRONINE LIOTHYRONINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC] ==
−
* smiles:
+
* taxonomic range:
−
** C1(C=C(O)C(I)=CC=1OC2(=C(I)C=C(C=C(I)2)CC([N+])C(=O)[O-]))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=AUYYCJSJGJYCDS-LBPRGKRZSA-N
+
 
* common name:
 
* common name:
−
** 3,5,3'-triiodo-L-thyronine
+
** TCA cycle VIII (helicobacter)
−
* molecular weight:
+
−
** 650.978   
+
 
* Synonym(s):
 
* Synonym(s):
−
** triiodothyronine
+
** Krebs cycle
−
** triothyrone
+
** tricarboxylic acid cycle
−
** 4-(3-iodo-4-hydroxy-phenoxy)-3,5-diiodophenylalanine
+
** TCA cycle
−
** L-3,5,3'-triiodothyronine
+
** citric acid cycle
−
** L-triiodothyronine
+
−
** T3
+
−
** 3,5,3'-triiodothyronine
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-10607]]
+
'''6''' reactions found over '''9''' reactions in the full pathway
−
* [[RXN-10615]]
+
* [[ACONITATEDEHYDR-RXN]]
−
* [[RXN-10609]]
+
** 1 associated gene(s):
−
== Reaction(s) known to produce the compound ==
+
*** [[Tiso_gene_13007]]
−
* [[THYROXINE-DEIODINASE-RXN]]
+
** 3 reconstruction source(s) associated:
−
== Reaction(s) of unknown directionality ==
+
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_13007]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[CITSYN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_18030]]
 +
*** [[Tiso_gene_9601]]
 +
*** [[Tiso_gene_9603]]
 +
*** [[Tiso_gene_9602]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[FUMHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_3691]]
 +
*** [[Tiso_gene_6720]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[ISOCITDEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_18262]]
 +
*** [[Tiso_gene_10809]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXNI-2]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_6754]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXNI-3 RXNI-3]
 
== External links  ==
 
== External links  ==
−
* CAS : 6893-02-3
+
{{#set: taxonomic range=TAX-2}}
−
* PUBCHEM:
+
{{#set: common name=TCA cycle VIII (helicobacter)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7048703 7048703]
+
{{#set: common name=Krebs cycle|tricarboxylic acid cycle|TCA cycle|citric acid cycle}}
−
* HMDB : HMDB00265
+
{{#set: reaction found=6}}
−
* LIGAND-CPD:
+
{{#set: total reaction=9}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02465 C02465]
+
{{#set: completion rate=67.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=533015 533015]
+
−
* METABOLIGHTS : MTBLC533015
+
−
{{#set: smiles=C1(C=C(O)C(I)=CC=1OC2(=C(I)C=C(C=C(I)2)CC([N+])C(=O)[O-]))}}
+
−
{{#set: inchi key=InChIKey=AUYYCJSJGJYCDS-LBPRGKRZSA-N}}
+
−
{{#set: common name=3,5,3'-triiodo-L-thyronine}}
+
−
{{#set: molecular weight=650.978    }}
+
−
{{#set: common name=triiodothyronine|triothyrone|4-(3-iodo-4-hydroxy-phenoxy)-3,5-diiodophenylalanine|L-3,5,3'-triiodothyronine|L-triiodothyronine|T3|3,5,3'-triiodothyronine}}
+
−
{{#set: consumed by=RXN-10607|RXN-10615|RXN-10609}}
+
−
{{#set: produced by=THYROXINE-DEIODINASE-RXN}}
+

Revision as of 15:59, 21 March 2018

Pathway REDCITCYC

  • taxonomic range:
  • common name:
    • TCA cycle VIII (helicobacter)
  • Synonym(s):
    • Krebs cycle
    • tricarboxylic acid cycle
    • TCA cycle
    • citric acid cycle

Reaction(s) found

6 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18444&oldid=31693"