Difference between revisions of "VERY-LONG-CHAIN-FATTY-ACYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] == * smiles: ** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7342 PWY-7342] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4070 TAX-40...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETATE 5-HYDROXYINDOLE_ACETATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7342 PWY-7342] ==
* smiles:
+
* taxonomic range:
** C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4070 TAX-4070]
* inchi key:
+
** InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 5-hydroxyindole acetate
+
** superpathway of nicotine biosynthesis
* molecular weight:
+
** 190.178   
+
 
* Synonym(s):
 
* Synonym(s):
** 5-hydroxyindoleacetic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''13''' reactions in the full pathway
* [[RXN-10780]]
+
* [[L-ASPARTATE-OXID-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_7285]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[PWY-5316]]
 +
** 0 associated gene:
 +
* [[QUINOPRIBOTRANS-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_141]]
 +
*** [[Tiso_gene_12892]]
 +
*** [[Tiso_gene_8723]]
 +
*** [[Tiso_gene_140]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5315 PWY-5315]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5315 PWY-5315]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=QUINOLINATE-SYNTHA-RXN QUINOLINATE-SYNTHA-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13057 RXN-13057]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13058 RXN-13058]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13059 RXN-13059]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13060 RXN-13060]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8248 RXN-8248]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8444 RXN-8444]
 
== External links  ==
 
== External links  ==
* CAS : 54-16-0
+
{{#set: taxonomic range=TAX-4070}}
* PUBCHEM:
+
{{#set: common name=superpathway of nicotine biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3772821 3772821]
+
{{#set: reaction found=3}}
* HMDB : HMDB00763
+
{{#set: total reaction=13}}
* LIGAND-CPD:
+
{{#set: completion rate=23.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C05635 C05635]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.3001356.html 3001356]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62622 62622]
+
{{#set: smiles=C1(C(O)=CC2(=C(C=1)NC=C2CC(=O)[O-]))}}
+
{{#set: inchi key=InChIKey=DUUGKQCEGZLZNO-UHFFFAOYSA-M}}
+
{{#set: common name=5-hydroxyindole acetate}}
+
{{#set: molecular weight=190.178    }}
+
{{#set: common name=5-hydroxyindoleacetic acid}}
+
{{#set: produced by=RXN-10780}}
+

Revision as of 16:00, 21 March 2018

Pathway PWY-7342

  • taxonomic range:
  • common name:
    • superpathway of nicotine biosynthesis
  • Synonym(s):

Reaction(s) found

3 reactions found over 13 reactions in the full pathway

Reaction(s) not found

External links