Difference between revisions of "Tiso gene 4096"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYPIMELYL-COA 3-HYDROXYPIMELYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6481 PWY-6481] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYPIMELYL-COA 3-HYDROXYPIMELYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6481 PWY-6481] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=VGEBXBQECGWCRH-JXUSAFQPSA-I
+
 
* common name:
 
* common name:
−
** 3-hydroxypimeloyl-CoA
+
** L-dopachrome biosynthesis
−
* molecular weight:
+
−
** 920.648   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxypimelyl-CoA
+
** melanin biosynthesis (proximal phase)
−
** 5-hydroxy-7-oxoheptanoyl-CoA
+
−
** 3-hydroxy-6-carboxyhexanoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
−
* [[RXN-15013]]
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_1791]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-11369]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-8483]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266574 45266574]
+
{{#set: taxonomic range=TAX-2759}}
−
* CHEBI:
+
{{#set: common name=L-dopachrome biosynthesis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57343 57343]
+
{{#set: common name=melanin biosynthesis (proximal phase)}}
−
* LIGAND-CPD:
+
{{#set: reaction found=3}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06714 C06714]
+
{{#set: total reaction=3}}
−
* HMDB : HMDB12155
+
{{#set: completion rate=100.0}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=VGEBXBQECGWCRH-JXUSAFQPSA-I}}
+
−
{{#set: common name=3-hydroxypimeloyl-CoA}}
+
−
{{#set: molecular weight=920.648    }}
+
−
{{#set: common name=3-hydroxypimelyl-CoA|5-hydroxy-7-oxoheptanoyl-CoA|3-hydroxy-6-carboxyhexanoyl-CoA}}
+
−
{{#set: reversible reaction associated=RXN-15013}}
+

Revision as of 15:00, 21 March 2018

Pathway PWY-6481

  • taxonomic range:
  • common name:
    • L-dopachrome biosynthesis
  • Synonym(s):
    • melanin biosynthesis (proximal phase)

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4096&oldid=31792"