Difference between revisions of "RXN0-2144"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * smiles: ** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3) * inchi key:...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2144 RXN0-2144] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-[acyl-carrier...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2144 RXN0-2144] ==
−
* smiles:
+
* direction:
−
** C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N
+
 
* common name:
 
* common name:
−
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
+
** 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
−
* molecular weight:
+
* ec number:
−
** 296.358   
+
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP
 
−
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-15684]]
+
** 1 [[b-Hydroxy-cis-D5-dodecenoyl-ACPs]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[Trans-D3-cis-D5-dodecenoyl-ACPs]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a (3R,5Z)-3-hydroxy-dodec-5-enoyl-[acp][c] '''=>''' 1 H2O[c] '''+''' 1 a (3E,5Z)-dodeca-3,5-dienoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6884]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY0-862]], (5Z)-dodec-5-enoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-862 PWY0-862]
 +
** '''5''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657891 90657891]
+
{{#set: common name=3-hydroxyacyl-[acyl-carrier-protein] dehydratase}}
−
{{#set: smiles=C(O)C23(SSC(CC1(=CC=CC=C1))(NC(=O)2)C(=O)N3)}}
+
{{#set: ec number=EC-4.2.1.59}}
−
{{#set: inchi key=InChIKey=POIIJAAGMGNXLO-VXGBXAGGSA-N}}
+
{{#set: gene associated=Tiso_gene_6884}}
−
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: in pathway=PWY0-862}}
−
{{#set: molecular weight=296.358    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfide-6-(hydroxymethyl)piperazine-2,5-dione}}
+
{{#set: reconstruction source=annotation-experimental_annotation}}
−
{{#set: produced by=RXN-15684}}
+
{{#set: reconstruction tool=pathwaytools}}

Revision as of 15:01, 21 March 2018

Reaction RXN0-2144

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-862, (5Z)-dodec-5-enoate biosynthesis: PWY0-862
    • 5 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

"3-hydroxyacyl-[acyl-carrier-protein] dehydratase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN0-2144&oldid=31873"