Difference between revisions of "L-GLUTAMATE-5-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) * inchi key...")
(Created page with "Category:Gene == Gene Tiso_gene_15098 == * right end position: ** 1490 * transcription direction: ** NEGATIVE * left end position: ** 31 * centisome position: ** 0.5921681...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] ==
+
== Gene Tiso_gene_15098 ==
−
* smiles:
+
* right end position:
−
** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])
+
** 1490
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** L-histidinol-phosphate
+
** 31
−
* molecular weight:
+
* centisome position:
−
** 220.144    
+
** 0.5921681    
 
* Synonym(s):
 
* Synonym(s):
−
** histidinol-P
 
−
** L-histidinol-p
 
−
** histidinol-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[HISTIDPHOS-RXN]]
+
* Reaction: [[GLUCONOLACT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[HISTAMINOTRANS-RXN]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-8783]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-2221]]
 +
* [[PWY-7165]]
 +
* [[NPGLUCAT-PWY]]
 +
* [[GLUCOSE1PMETAB-PWY]]
 +
* [[PWY3DJ-35471]]
 +
* [[PWY-5530]]
 +
* [[DHGLUCONATE-PYR-CAT-PWY]]
 
== External links  ==
 
== External links  ==
−
* CAS : 25679-93-0
+
{{#set: right end position=1490}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791964 49791964]
+
{{#set: left end position=31}}
−
* KNAPSACK : C00007480
+
{{#set: centisome position=0.5921681   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=GLUCONOLACT-RXN|RXN-8783}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01100 C01100]
+
{{#set: pathway associated=PWY-2221|PWY-7165|NPGLUCAT-PWY|GLUCOSE1PMETAB-PWY|PWY3DJ-35471|PWY-5530|DHGLUCONATE-PYR-CAT-PWY}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57980 57980]
+
−
* BIGG : hisp
+
−
{{#set: smiles=C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])}}
+
−
{{#set: inchi key=InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M}}
+
−
{{#set: common name=L-histidinol-phosphate}}
+
−
{{#set: molecular weight=220.144   }}
+
−
{{#set: common name=histidinol-P|L-histidinol-p|histidinol-phosphate}}
+
−
{{#set: consumed by=HISTIDPHOS-RXN}}
+
−
{{#set: produced by=HISTAMINOTRANS-RXN}}
+

Revision as of 15:01, 21 March 2018

Gene Tiso_gene_15098

  • right end position:
    • 1490
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 31
  • centisome position:
    • 0.5921681
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-GLUTAMATE-5-P&oldid=31882"