Difference between revisions of "Aliphatic-Amines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042] ==
* smiles:
+
* taxonomic range:
** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
** hydroxybupropion
+
** glycolysis IV (plant cytosol)
* molecular weight:
+
** 256.752   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** glycolysis 4
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''9''' reactions found over '''10''' reactions in the full pathway
* [[RXN66-181]]
+
* [[2.7.1.90-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_596]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[2PGADEHYDRAT-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_8720]]
 +
*** [[Tiso_gene_14718]]
 +
*** [[Tiso_gene_5619]]
 +
*** [[Tiso_gene_13317]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[3PGAREARR-RXN]]
 +
** 16 associated gene(s):
 +
*** [[Tiso_gene_15048]]
 +
*** [[Tiso_gene_7201]]
 +
*** [[Tiso_gene_9922]]
 +
*** [[Tiso_gene_2841]]
 +
*** [[Tiso_gene_14530]]
 +
*** [[Tiso_gene_16754]]
 +
*** [[Tiso_gene_2365]]
 +
*** [[Tiso_gene_16271]]
 +
*** [[Tiso_gene_5468]]
 +
*** [[Tiso_gene_20311]]
 +
*** [[Tiso_gene_14664]]
 +
*** [[Tiso_gene_15391]]
 +
*** [[Tiso_gene_14212]]
 +
*** [[Tiso_gene_10516]]
 +
*** [[Tiso_gene_9923]]
 +
*** [[Tiso_gene_2667]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[6PFRUCTPHOS-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_5733]]
 +
*** [[Tiso_gene_596]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[F16ALDOLASE-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_12272]]
 +
*** [[Tiso_gene_65]]
 +
*** [[Tiso_gene_9119]]
 +
*** [[Tiso_gene_14568]]
 +
*** [[Tiso_gene_9179]]
 +
*** [[Tiso_gene_9118]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[GAPOXNPHOSPHN-RXN]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_20000]]
 +
*** [[Tiso_gene_235]]
 +
*** [[Tiso_gene_10646]]
 +
*** [[Tiso_gene_3344]]
 +
*** [[Tiso_gene_6766]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[PEPDEPHOS-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_18206]]
 +
*** [[Tiso_gene_14504]]
 +
*** [[Tiso_gene_974]]
 +
*** [[Tiso_gene_14505]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_3526]]
 +
*** [[Tiso_gene_18264]]
 +
*** [[Tiso_gene_3527]]
 +
*** [[Tiso_gene_18263]]
 +
*** [[Tiso_gene_12104]]
 +
*** [[Tiso_gene_14642]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[TRIOSEPISOMERIZATION-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_19961]]
 +
*** [[Tiso_gene_20000]]
 +
*** [[Tiso_gene_19962]]
 +
*** [[Tiso_gene_10646]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=1.2.1.9-RXN 1.2.1.9-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202442 25202442]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-1042 PWY-1042]
* HMDB : HMDB12235
+
{{#set: taxonomic range=TAX-33090}}
{{#set: smiles=CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)}}
+
{{#set: common name=glycolysis IV (plant cytosol)}}
{{#set: inchi key=InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O}}
+
{{#set: common name=glycolysis 4}}
{{#set: common name=hydroxybupropion}}
+
{{#set: reaction found=9}}
{{#set: molecular weight=256.752    }}
+
{{#set: total reaction=10}}
{{#set: produced by=RXN66-181}}
+
{{#set: completion rate=90.0}}

Revision as of 15:01, 21 March 2018

Pathway PWY-1042

  • taxonomic range:
  • common name:
    • glycolysis IV (plant cytosol)
  • Synonym(s):
    • glycolysis 4

Reaction(s) found

9 reactions found over 10 reactions in the full pathway

Reaction(s) not found

External links