Difference between revisions of "DHHB-METHYLTRANSFER-RXN"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7431 PWY-7431] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) * common na...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == |
− | * | + | * smiles: |
− | ** [ | + | ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) |
* common name: | * common name: | ||
− | ** | + | ** L-histidinol-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M | ||
+ | * molecular weight: | ||
+ | ** 220.144 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** histidinol-P | ||
+ | ** L-histidinol-p | ||
+ | ** histidinol-phosphate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[HISTIDPHOS-RXN]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[HISTAMINOTRANS-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 25679-93-0 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791964 49791964] |
− | {{#set: | + | * KNAPSACK : C00007480 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01100 C01100] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57980 57980] | ||
+ | * BIGG : hisp | ||
+ | {{#set: smiles=C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])}} | ||
+ | {{#set: common name=L-histidinol-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M}} | ||
+ | {{#set: molecular weight=220.144 }} | ||
+ | {{#set: common name=histidinol-P|L-histidinol-p|histidinol-phosphate}} | ||
+ | {{#set: consumed by=HISTIDPHOS-RXN}} | ||
+ | {{#set: produced by=HISTAMINOTRANS-RXN}} |
Revision as of 15:01, 21 March 2018
Contents
Metabolite L-HISTIDINOL-P
- smiles:
- C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])
- common name:
- L-histidinol-phosphate
- inchi key:
- InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M
- molecular weight:
- 220.144
- Synonym(s):
- histidinol-P
- L-histidinol-p
- histidinol-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])" cannot be used as a page name in this wiki.