Difference between revisions of "PWY-5651"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CYANOPYRIDINE 3-CYANOPYRIDINE] == * smiles: ** C(C1(=CN=CC=C1))#N * inchi key: ** InChIKey=GZ...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-218 RXN1G-218] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-delta9-3-oxo-C28:1-[acy...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CYANOPYRIDINE 3-CYANOPYRIDINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-218 RXN1G-218] ==
* smiles:
+
* direction:
** C(C1(=CN=CC=C1))#N
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 3-cyanopyridine
+
** cis-delta9-3-oxo-C28:1-[acyl-carrier protein] synthase
* molecular weight:
+
* ec number:
** 104.111   
+
** [http://enzyme.expasy.org/EC/2.3.1.M1 EC-2.3.1.M1]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[R313-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[cis-delta7-cerotoyl-ACPs]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[cis-delta9-3-oxo-montanoyl-ACPs]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a cis-delta7-C26:1-[acp][c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 a cis-delta9-3-oxo-C28:1-[acp][c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_19302]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14485]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_15991]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 100-54-9
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=cis-delta9-3-oxo-C28:1-[acyl-carrier protein] synthase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=79 79]
+
{{#set: ec number=EC-2.3.1.M1}}
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_19302|Tiso_gene_14485|Tiso_gene_15991}}
** [http://www.chemspider.com/Chemical-Structure.78.html 78]
+
{{#set: in pathway=PWYG-321}}
* CHEBI:
+
{{#set: reconstruction category=orthology}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86556 86556]
+
{{#set: reconstruction source=orthology-esiliculosus}}
* NCI:
+
{{#set: reconstruction tool=pantograph}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=17558 17558]
+
{{#set: smiles=C(C1(=CN=CC=C1))#N}}
+
{{#set: inchi key=InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N}}
+
{{#set: common name=3-cyanopyridine}}
+
{{#set: molecular weight=104.111    }}
+
{{#set: consumed by=R313-RXN}}
+

Revision as of 15:02, 21 March 2018

Reaction RXN1G-218

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cis-delta9-3-oxo-C28:1-[acyl-carrier protein] synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"cis-delta9-3-oxo-C28:1-[acyl-carrier protein] synthase" cannot be used as a page name in this wiki.