Difference between revisions of "SERSYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7736 PWY-7736] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CYANOPYRIDINE 3-CYANOPYRIDINE] == * smiles: ** C(C1(=CN=CC=C1))#N * common name: ** 3-cyanopy...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7736 PWY-7736] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CYANOPYRIDINE 3-CYANOPYRIDINE] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** C(C1(=CN=CC=C1))#N
 
* common name:
 
* common name:
** stellatic acid biosynthesis
+
** 3-cyanopyridine
 +
* inchi key:
 +
** InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 104.111   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''8''' reactions in the full pathway
+
* [[R313-RXN]]
* [[FARNESYLTRANSTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** 2 associated gene(s):
+
== Reaction(s) of unknown directionality ==
*** [[Tiso_gene_16284]]
+
*** [[Tiso_gene_7305]]
+
** 6 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-esiliculosus]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-athaliana]]
+
*** [[orthology-synechocystis]]
+
*** [[manual-primary_network]]
+
* [[FPPSYN-RXN]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_16284]]
+
** 4 reconstruction source(s) associated:
+
*** [[orthology-athaliana]]
+
*** [[orthology-synechocystis]]
+
*** [[orthology-esiliculosus]]
+
*** [[manual-primary_network]]
+
* [[GPPSYN-RXN]]
+
** 9 associated gene(s):
+
*** [[Tiso_gene_19542]]
+
*** [[Tiso_gene_18201]]
+
*** [[Tiso_gene_16284]]
+
*** [[Tiso_gene_2848]]
+
*** [[Tiso_gene_1035]]
+
*** [[Tiso_gene_4719]]
+
*** [[Tiso_gene_11582]]
+
*** [[Tiso_gene_13582]]
+
*** [[Tiso_gene_10317]]
+
** 5 reconstruction source(s) associated:
+
*** [[orthology-athaliana]]
+
*** [[orthology-creinhardtii]]
+
*** [[orthology-synechocystis]]
+
*** [[orthology-esiliculosus]]
+
*** [[manual-primary_network]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17161 RXN-17161]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17162 RXN-17162]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17163 RXN-17163]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17164 RXN-17164]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8813 RXN-8813]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4751}}
+
* CAS : 100-54-9
{{#set: common name=stellatic acid biosynthesis}}
+
* PUBCHEM:
{{#set: reaction found=3}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=79 79]
{{#set: total reaction=8}}
+
* CHEMSPIDER:
{{#set: completion rate=38.0}}
+
** [http://www.chemspider.com/Chemical-Structure.78.html 78]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86556 86556]
 +
* NCI:
 +
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=17558 17558]
 +
{{#set: smiles=C(C1(=CN=CC=C1))#N}}
 +
{{#set: common name=3-cyanopyridine}}
 +
{{#set: inchi key=InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=104.111    }}
 +
{{#set: consumed by=R313-RXN}}

Revision as of 15:02, 21 March 2018

Metabolite 3-CYANOPYRIDINE

  • smiles:
    • C(C1(=CN=CC=C1))#N
  • common name:
    • 3-cyanopyridine
  • inchi key:
    • InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N
  • molecular weight:
    • 104.111
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links