Difference between revisions of "Tiso gene 10185"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DITHIOTHREITOL DITHIOTHREITOL] == * smiles: ** C(S)C(O)C(O)CS * inchi key: ** InChIKey=VHJLVAAB...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] == * smiles: ** C(NC1(NC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)CO |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 5-amino-6-(D-ribitylamino)uracil |
+ | * inchi key: | ||
+ | ** InChIKey=XKQZIXVJVUPORE-RPDRRWSUSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 276.249 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 6-(1-D-ribitylamino)-5-amino-2,4-dihydroxypyrimidine |
− | ** | + | ** 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione |
− | ** | + | ** ARP |
− | ** | + | ** 6-(1-D-ribitylamino)-5-aminouracil |
+ | ** 5-amino-6-(1-D-ribitylamino)pyrimidine-2,4(1H,3H)-dione | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RIBOFLAVIN-SYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04732 C04732] |
− | * | + | * HMDB : HMDB11106 |
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15934 15934] |
− | * | + | * BIGG : 4r5au |
− | {{#set: smiles=C( | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=193516 193516] |
− | {{#set: | + | {{#set: smiles=C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)CO}} |
− | {{#set: molecular weight= | + | {{#set: common name=5-amino-6-(D-ribitylamino)uracil}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=XKQZIXVJVUPORE-RPDRRWSUSA-N}} |
− | {{#set: | + | {{#set: molecular weight=276.249 }} |
+ | {{#set: common name=6-(1-D-ribitylamino)-5-amino-2,4-dihydroxypyrimidine|5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione|ARP|6-(1-D-ribitylamino)-5-aminouracil|5-amino-6-(1-D-ribitylamino)pyrimidine-2,4(1H,3H)-dione}} | ||
+ | {{#set: produced by=RIBOFLAVIN-SYN-RXN}} |
Revision as of 16:02, 21 March 2018
Contents
Metabolite AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE
- smiles:
- C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)CO
- common name:
- 5-amino-6-(D-ribitylamino)uracil
- inchi key:
- InChIKey=XKQZIXVJVUPORE-RPDRRWSUSA-N
- molecular weight:
- 276.249
- Synonym(s):
- 6-(1-D-ribitylamino)-5-amino-2,4-dihydroxypyrimidine
- 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione
- ARP
- 6-(1-D-ribitylamino)-5-aminouracil
- 5-amino-6-(1-D-ribitylamino)pyrimidine-2,4(1H,3H)-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links