Difference between revisions of "Tiso gene 14344"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6941 PWY-6941] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18011 CPD-18011] == * smiles: ** C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O * common na...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6941 PWY-6941] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18011 CPD-18011] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O
 
* common name:
 
* common name:
−
** styrene degradation
+
** 2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate
 +
* inchi key:
 +
** InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L
 +
* molecular weight:
 +
** 332.2   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[PHENDEHYD-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** 0 associated gene:
+
* [[2.4.1.213-RXN]]
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12764 RXN-12764]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12765 RXN-12765]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
−
{{#set: common name=styrene degradation}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658883 90658883]
−
{{#set: reaction found=1}}
+
* CHEBI:
−
{{#set: total reaction=3}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87089 87089]
−
{{#set: completion rate=33.0}}
+
{{#set: smiles=C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O}}
 +
{{#set: common name=2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate}}
 +
{{#set: inchi key=InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L}}
 +
{{#set: molecular weight=332.2    }}
 +
{{#set: reversible reaction associated=2.4.1.213-RXN}}

Revision as of 15:02, 21 March 2018

Metabolite CPD-18011

  • smiles:
    • C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O
  • common name:
    • 2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate
  • inchi key:
    • InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L
  • molecular weight:
    • 332.2
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14344&oldid=32009"