Difference between revisions of "TCM3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == * smiles: ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3)))...")
(Created page with "Category:Gene == Gene Tiso_gene_14344 == * right end position: ** 5704 * transcription direction: ** POSITIVE * left end position: ** 4144 * centisome position: ** 72.5871...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] ==
+
== Gene Tiso_gene_14344 ==
−
* smiles:
+
* right end position:
−
** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))
+
** 5704
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O
+
** POSITIVE
−
* common name:
+
* left end position:
−
** strictosidine
+
** 4144
−
* molecular weight:
+
* centisome position:
−
** 531.581    
+
** 72.58714    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-α(S)-strictosidine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.1.26.5-RXN]]
−
* [[STRICTOSIDINE-SYNTHASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN0-6480]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY0-1479]]
 
== External links  ==
 
== External links  ==
−
* CAS : 20824-29-7
+
{{#set: right end position=5704}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123291 44123291]
+
{{#set: left end position=4144}}
−
* CHEBI:
+
{{#set: centisome position=72.58714   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17559 17559]
+
{{#set: reaction associated=3.1.26.5-RXN|RXN0-6480}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY0-1479}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03470 C03470]
+
−
{{#set: smiles=C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))}}
+
−
{{#set: inchi key=InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O}}
+
−
{{#set: common name=strictosidine}}
+
−
{{#set: molecular weight=531.581   }}
+
−
{{#set: common name=3-α(S)-strictosidine}}
+
−
{{#set: produced by=STRICTOSIDINE-SYNTHASE-RXN}}
+

Revision as of 16:02, 21 March 2018

Gene Tiso_gene_14344

  • right end position:
    • 5704
  • transcription direction:
    • POSITIVE
  • left end position:
    • 4144
  • centisome position:
    • 72.58714
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TCM3&oldid=32012"