Difference between revisions of "Tiso gene 4395"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_879 == * left end position: ** 7505 * transcription direction: ** POSITIVE * right end position: ** 9477 * centisome position: ** 26.956648...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * co...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_879 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] ==
* left end position:
+
* smiles:
** 7505
+
** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
* transcription direction:
+
* common name:
** POSITIVE
+
** 6,7-dehydrobaicalein
* right end position:
+
* inchi key:
** 9477
+
** InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
* centisome position:
+
* molecular weight:
** 26.956648    
+
** 268.225    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.4.11.5-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-14240]]
***ec-number
+
== Reaction(s) of unknown directionality ==
** experimental_annotation
+
***ec-number
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=7505}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86200952 86200952]
{{#set: right end position=9477}}
+
{{#set: smiles=C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))}}
{{#set: centisome position=26.956648   }}
+
{{#set: common name=6,7-dehydrobaicalein}}
{{#set: reaction associated=3.4.11.5-RXN}}
+
{{#set: inchi key=InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=268.225   }}
 +
{{#set: produced by=RXN-14240}}

Revision as of 15:02, 21 March 2018

Metabolite CPD-15172

  • smiles:
    • C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
  • common name:
    • 6,7-dehydrobaicalein
  • inchi key:
    • InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
  • molecular weight:
    • 268.225
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links