Difference between revisions of "BETSYN-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
(Created page with "Category:Gene == Gene Tiso_gene_5041 == * right end position: ** 13596 * transcription direction: ** POSITIVE * left end position: ** 9685 * centisome position: ** 69.3023...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] ==
+
== Gene Tiso_gene_5041 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** 13596
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** OPC4-CoA
+
** 9685
−
* molecular weight:
+
* centisome position:
−
** 983.813    
+
** 69.30233    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10707]]
+
* Reaction: [[GALACTOKIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-10700]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-6317]]
 +
* [[PWY66-422]]
 +
* [[PWY-6527]]
 +
* [[PWY-3821]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=13596}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237211 44237211]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: left end position=9685}}
−
{{#set: inchi key=InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J}}
+
{{#set: centisome position=69.30233   }}
−
{{#set: common name=OPC4-CoA}}
+
{{#set: reaction associated=GALACTOKIN-RXN}}
−
{{#set: molecular weight=983.813   }}
+
{{#set: pathway associated=PWY-6317|PWY66-422|PWY-6527|PWY-3821}}
−
{{#set: consumed by=RXN-10707}}
+
−
{{#set: produced by=RXN-10700}}
+

Revision as of 15:03, 21 March 2018

Gene Tiso_gene_5041

  • right end position:
    • 13596
  • transcription direction:
    • POSITIVE
  • left end position:
    • 9685
  • centisome position:
    • 69.30233
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=BETSYN-PWY&oldid=32084"