Difference between revisions of "Tiso gene 10912"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=...")
(Created page with "Category:Gene == Gene Tiso_gene_5166 == * right end position: ** 13821 * transcription direction: ** NEGATIVE * left end position: ** 9063 * centisome position: ** 51.3950...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] ==
+
== Gene Tiso_gene_5166 ==
−
* smiles:
+
* right end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 13821
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HJEGYLSHIKPENR-DAXVLCLXSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 18-hydroxylinoleoyl-CoA
+
** 9063
−
* molecular weight:
+
* centisome position:
−
** 1041.936    
+
** 51.395035    
 
* Synonym(s):
 
* Synonym(s):
−
** ω-hydroxylinoleoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16118]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=13821}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659898 90659898]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=9063}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84904 84904]
+
{{#set: centisome position=51.395035   }}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
{{#set: inchi key=InChIKey=HJEGYLSHIKPENR-DAXVLCLXSA-J}}
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
{{#set: common name=18-hydroxylinoleoyl-CoA}}
+
−
{{#set: molecular weight=1041.936   }}
+
−
{{#set: common name=ω-hydroxylinoleoyl-CoA}}
+
−
{{#set: consumed by=RXN-16118}}
+

Revision as of 15:03, 21 March 2018

Gene Tiso_gene_5166

  • right end position:
    • 13821
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 9063
  • centisome position:
    • 51.395035
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10912&oldid=32131"