Difference between revisions of "PWY-3301"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4961 RXN0-4961] == * direction: ** LEFT-TO-RIGHT * common name: ** dna_polymerase * ec number:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4961 RXN0-4961] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** dna_polymerase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.11 EC-3.1.11] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[DNA-N]][c] '''+''' n [[WATER]][c] '''=>''' n [[Nucleoside-Monophosphates]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 DNAn[c] '''+''' n H2O[c] '''=>''' n a nucleoside 5'-monophosphate[c] |
− | == | + | |
− | * [[ | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_11822]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_7025]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_1474]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_17523]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=dna_polymerase}} | |
− | + | {{#set: ec number=EC-3.1.11}} | |
− | + | {{#set: gene associated=Tiso_gene_11822|Tiso_gene_7025|Tiso_gene_1474|Tiso_gene_17523}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:04, 21 March 2018
Contents
Reaction RXN0-4961
- direction:
- LEFT-TO-RIGHT
- common name:
- dna_polymerase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DNA-N[c] + n WATER[c] => n Nucleoside-Monophosphates[c]
- With common name(s):
- 1 DNAn[c] + n H2O[c] => n a nucleoside 5'-monophosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11822
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_7025
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_1474
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_17523
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation