Difference between revisions of "ORNDEG-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14503 RXN-14503] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O * common name:...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14503 RXN-14503] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O
 +
* common name:
 +
** α-D-glucuronate 1-phosphate
 +
* inchi key:
 +
** InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K
 +
* molecular weight:
 +
** 271.097   
 
* Synonym(s):
 
* Synonym(s):
 +
** glucuronate-1-P
 +
** glucuronate-1-phosphate
 +
** D-glucuronate-1-P
 +
** D-glucuronate-1-phosphate
 +
** 1-phospho-α-D-glucuronate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[GLCUR1PUT]]
−
** 1 [[CPD-15377]][c] '''<=>''' 1 [[D-Xylopyranose]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[GLUCURONOKINASE-RXN]]
−
** 1 aldehydo-D-xylose[c] '''<=>''' 1 D-xylopyranose[c]
+
* [[GLCURK]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
* [[2.7.7.44-RXN]]
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* LIGAND-CPD:
−
{{#set: in pathway=}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05385 C05385]
−
{{#set: reconstruction category=annotation}}
+
* HMDB : HMDB03976
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
* CHEBI:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57897 57897]
 +
* BIGG : glcur1p
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244365 25244365]
 +
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O}}
 +
{{#set: common name=&alpha;-D-glucuronate 1-phosphate}}
 +
{{#set: inchi key=InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K}}
 +
{{#set: molecular weight=271.097    }}
 +
{{#set: common name=glucuronate-1-P|glucuronate-1-phosphate|D-glucuronate-1-P|D-glucuronate-1-phosphate|1-phospho-&alpha;-D-glucuronate}}
 +
{{#set: consumed by=GLCUR1PUT}}
 +
{{#set: produced by=GLUCURONOKINASE-RXN|GLCURK}}
 +
{{#set: reversible reaction associated=2.7.7.44-RXN}}

Revision as of 15:04, 21 March 2018

Metabolite CPD-510

  • smiles:
    • C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O
  • common name:
    • α-D-glucuronate 1-phosphate
  • inchi key:
    • InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K
  • molecular weight:
    • 271.097
  • Synonym(s):
    • glucuronate-1-P
    • glucuronate-1-phosphate
    • D-glucuronate-1-P
    • D-glucuronate-1-phosphate
    • 1-phospho-α-D-glucuronate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ORNDEG-PWY&oldid=32212"