Difference between revisions of "N-terminal-L-cysteine-sulfinate"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12058 == * left end position: ** 797 * transcription direction: ** POSITIVE * right end position: ** 5191 * centisome position: ** 10.86719...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_12058 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
−
* left end position:
+
* smiles:
−
** 797
+
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
−
* right end position:
+
* inchi key:
−
** 5191
+
** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
−
* centisome position:
+
* molecular weight:
−
** 10.867194    
+
** 447.424    
 
* Synonym(s):
 
* Synonym(s):
 +
** di-trans,poly-cis-geranylgeranyl diphosphate
 +
** ω,E,E,Z-geranylgeranyl diphosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
== Reaction(s) of unknown directionality ==
−
***ec-number
+
* [[RXN-13323]]
−
== Pathways associated ==
+
* [[RXN0-5180]]
−
* [[PWY-6386]]
+
−
* [[PWY-6387]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=797}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826]
−
{{#set: right end position=5191}}
+
* CHEBI:
−
{{#set: centisome position=10.867194   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639]
−
{{#set: reaction associated=UDPNACETYLMURAMATEDEHYDROG-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-6386|PWY-6387}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356]
 +
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
 +
{{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
 +
{{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}}
 +
{{#set: molecular weight=447.424   }}
 +
{{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}}
 +
{{#set: reversible reaction associated=RXN-13323|RXN0-5180}}

Revision as of 15:04, 21 March 2018

Metabolite CPD0-1028

  • smiles:
    • CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
  • common name:
    • 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
  • inchi key:
    • InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
  • molecular weight:
    • 447.424
  • Synonym(s):
    • di-trans,poly-cis-geranylgeranyl diphosphate
    • ω,E,E,Z-geranylgeranyl diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-terminal-L-cysteine-sulfinate&oldid=32218"