Difference between revisions of "5-AMINO-LEVULINATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10413 CPD-10413] == * smiles: ** C1(=C(C=CC(O)=C1)C2(C(O)CC3(C(O2)=CC(O)=CC(O)=3))) * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_20023 == * right end position: ** 1487 * transcription direction: ** POSITIVE * left end position: ** 227 * centisome position: ** 12.39083...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_20023 == |
− | * | + | * right end position: |
− | ** | + | ** 1487 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 227 |
− | * | + | * centisome position: |
− | ** | + | ** 12.39083 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[SUPEROX-DISMUT-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
+ | * [[DETOX1-PWY]] | ||
+ | * [[PWY-6854]] | ||
+ | * [[DETOX1-PWY-1]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1487}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=227}} | |
− | + | {{#set: centisome position=12.39083 }} | |
− | + | {{#set: reaction associated=SUPEROX-DISMUT-RXN}} | |
− | + | {{#set: pathway associated=DETOX1-PWY|PWY-6854|DETOX1-PWY-1}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:04, 21 March 2018
Gene Tiso_gene_20023
- right end position:
- 1487
- transcription direction:
- POSITIVE
- left end position:
- 227
- centisome position:
- 12.39083
- Synonym(s):
Reactions associated
- Reaction: SUPEROX-DISMUT-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation