Difference between revisions of "PWY-7394"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R600 R600] == * direction: ** LEFT-TO-RIGHT * common name: ** R600 * Synonym(s): == Reaction Formu...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C |
* common name: | * common name: | ||
| − | ** | + | ** 4α-methyl-5α-cholesta-8-en-3-one |
| + | * inchi key: | ||
| + | ** InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N | ||
| + | * molecular weight: | ||
| + | ** 398.671 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-18]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263323 44263323] | |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87050 87050] |
| − | {{#set: | + | * HMDB : HMDB12174 |
| − | {{#set: | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C}} |
| − | {{#set: | + | {{#set: common name=4α-methyl-5α-cholesta-8-en-3-one}} |
| + | {{#set: inchi key=InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N}} | ||
| + | {{#set: molecular weight=398.671 }} | ||
| + | {{#set: produced by=RXN66-18}} | ||
Revision as of 16:05, 21 March 2018
Contents
Metabolite CPD-8614
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
- common name:
- 4α-methyl-5α-cholesta-8-en-3-one
- inchi key:
- InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
- molecular weight:
- 398.671
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
