Difference between revisions of "DOPAQUINONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * inchi key: ** InChIKey=QIVB...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7411 PWY-7411] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7411 PWY-7411] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** phosphatidate biosynthesis (yeast) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''5''' reactions found over '''5''' reactions in the full pathway |
| − | * [[ | + | * [[1.1.1.8-RXN]] |
| − | * [[ | + | ** 6 associated gene(s): |
| − | + | *** [[Tiso_gene_6069]] | |
| − | * [[ | + | *** [[Tiso_gene_3718]] |
| − | * [[ | + | *** [[Tiso_gene_2810]] |
| − | * [[ | + | *** [[Tiso_gene_2811]] |
| − | == Reaction(s) | + | *** [[Tiso_gene_13013]] |
| + | *** [[Tiso_gene_15777]] | ||
| + | ** 6 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | * [[RXN-15043]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_13959]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-15044]] | ||
| + | ** 0 associated gene: | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | * [[RXN-15045]] | ||
| + | ** 0 associated gene: | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | * [[RXN-15046]] | ||
| + | ** 0 associated gene: | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=phosphatidate biosynthesis (yeast)}} | |
| − | + | {{#set: reaction found=5}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 16:05, 21 March 2018
Pathway PWY-7411
- taxonomic range:
- common name:
- phosphatidate biosynthesis (yeast)
- Synonym(s):
Reaction(s) found
5 reactions found over 5 reactions in the full pathway
- 1.1.1.8-RXN
- 6 associated gene(s):
- 6 reconstruction source(s) associated:
- RXN-15043
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-15044
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-15045
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-15046
- 0 associated gene:
- 2 reconstruction source(s) associated:
