Difference between revisions of "Tiso gene 9290"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAQUINONE DOPAQUINONE] == * smiles: ** C([O-])(=O)C([N+])CC1(=CC(=O)C(=O)C=C1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_10809 == * right end position: ** 3307 * transcription direction: ** POSITIVE * left end position: ** 36 * centisome position: ** 0.3136435...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10809 == |
− | * | + | * right end position: |
− | ** | + | ** 3307 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 36 |
− | * | + | * centisome position: |
− | ** | + | ** 0.3136435 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[ISOCITDEH-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[RXN- | + | ** Source: [[annotation-experimental_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[RXN-8642]] |
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9951]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5913]] | ||
+ | * [[REDCITCYC]] | ||
+ | * [[PWY-7268]] | ||
+ | * [[P23-PWY]] | ||
+ | * [[P105-PWY]] | ||
+ | * [[PWY-6969]] | ||
+ | * [[FERMENTATION-PWY]] | ||
+ | * [[PWY-6728]] | ||
+ | * [[PWY-6549]] | ||
+ | * [[PWY-7254]] | ||
+ | * [[PWY-7124]] | ||
+ | * [[TCA]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3307}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=36}} | |
− | + | {{#set: centisome position=0.3136435 }} | |
− | + | {{#set: reaction associated=ISOCITDEH-RXN|RXN-8642|RXN-9951}} | |
− | + | {{#set: pathway associated=PWY-5913|REDCITCYC|PWY-7268|P23-PWY|P105-PWY|PWY-6969|FERMENTATION-PWY|PWY-6728|PWY-6549|PWY-7254|PWY-7124|TCA}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:05, 21 March 2018
Gene Tiso_gene_10809
- right end position:
- 3307
- transcription direction:
- POSITIVE
- left end position:
- 36
- centisome position:
- 0.3136435
- Synonym(s):
Reactions associated
- Reaction: ISOCITDEH-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-8642
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-9951
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
Pathways associated
- PWY-5913
- REDCITCYC
- PWY-7268
- P23-PWY
- P105-PWY
- PWY-6969
- FERMENTATION-PWY
- PWY-6728
- PWY-6549
- PWY-7254
- PWY-7124
- TCA