Difference between revisions of "Tiso gene 4419"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9873 == * Synonym(s): == Reactions associated == * 1.14.11.2-RXN ** pantograph-esiliculosus * RXN490-3641 ** [[pantograph]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == * smiles: ** [CH](=O)C1(=CC=C(O)C(N)=C1) * common name: ** 3-amino-4-hydr...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == |
+ | * smiles: | ||
+ | ** [CH](=O)C1(=CC=C(O)C(N)=C1) | ||
+ | * common name: | ||
+ | ** 3-amino-4-hydroxybenzaldehyde | ||
+ | * inchi key: | ||
+ | ** InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 137.138 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | * [[RXN-13871]] |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: reaction associated= | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11521082 11521082] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78237 78237] | ||
+ | {{#set: smiles=[CH](=O)C1(=CC=C(O)C(N)=C1)}} | ||
+ | {{#set: common name=3-amino-4-hydroxybenzaldehyde}} | ||
+ | {{#set: inchi key=InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=137.138 }} | ||
+ | {{#set: reversible reaction associated=RXN-13871}} |
Revision as of 15:05, 21 March 2018
Contents
Metabolite CPD-7367
- smiles:
- [CH](=O)C1(=CC=C(O)C(N)=C1)
- common name:
- 3-amino-4-hydroxybenzaldehyde
- inchi key:
- InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N
- molecular weight:
- 137.138
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C1(=CC=C(O)C(N)=C1)" cannot be used as a page name in this wiki.