Difference between revisions of "Tiso gene 14709"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14318 == * left end position: ** 3632 * transcription direction: ** POSITIVE * right end position: ** 3846 * centisome position: ** 63.4188...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] == * smiles: ** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] == |
| − | * | + | * smiles: |
| − | ** | + | ** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3) |
| − | * | + | * common name: |
| − | ** | + | ** UDP-β-L-arabinopyranose |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 534.263 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[UDP-ARABINOSE-4-EPIMERASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246220 25246220] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61457 61457] |
| − | {{#set: reaction associated= | + | {{#set: smiles=C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)}} |
| − | + | {{#set: common name=UDP-β-L-arabinopyranose}} | |
| + | {{#set: inchi key=InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L}} | ||
| + | {{#set: molecular weight=534.263 }} | ||
| + | {{#set: reversible reaction associated=UDP-ARABINOSE-4-EPIMERASE-RXN}} | ||
Revision as of 15:07, 21 March 2018
Contents
Metabolite CPD-12513
- smiles:
- C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)
- common name:
- UDP-β-L-arabinopyranose
- inchi key:
- InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L
- molecular weight:
- 534.263
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)" cannot be used as a page name in this wiki.
