Difference between revisions of "Tiso gene 1253"

Revision as of 16:08, 21 March 2018

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15667 CPD-15667] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine55 tRNA-uridine55] ==
-* smiles:
-** CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
-* inchi key:
-** InChIKey=FDXHXLPCLXEYSU-DXAZUOFZSA-J
 * common name:
-** 6-cis, 3-oxo-tridecenoyl-CoA
+** a uridine55 in tRNA
-* molecular weight:
-** 971.802
 * Synonym(s):
-** 6Z, 3-oxo-tridecenoyl-CoA
+** a tRNA uridine55
 == Reaction(s) known to consume the compound ==
-* [[RXN-14774]]
+* [[RXN-11839]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=a uridine55 in tRNA}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657308 90657308]
+{{#set: common name=a tRNA uridine55}}
-{{#set: smiles=CCCCCCC=CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+{{#set: consumed by=RXN-11839}}
-{{#set: inchi key=InChIKey=FDXHXLPCLXEYSU-DXAZUOFZSA-J}}
-{{#set: common name=6-cis, 3-oxo-tridecenoyl-CoA}}
-{{#set: molecular weight=971.802    }}
-{{#set: common name=6Z, 3-oxo-tridecenoyl-CoA}}
-{{#set: consumed by=RXN-14774}}