Difference between revisions of "PWY-2722"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] == * smiles: ** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R313-RXN R313-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** probable_nitrile_hydratase *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-690 CPD-690] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R313-RXN R313-RXN] ==
−
* smiles:
+
* direction:
−
** CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H
+
 
* common name:
 
* common name:
−
** adenosyl-cobyrinate a,c-diamide
+
** probable_nitrile_hydratase
−
* molecular weight:
+
* ec number:
−
** 1182.137   
+
** [http://enzyme.expasy.org/EC/4.2.1.84 EC-4.2.1.84]
 
* Synonym(s):
 
* Synonym(s):
−
** adenosyl-cobyrinic acid a,c-diamide
 
−
** Adenosyl cobyrinate diamide
 
−
** Adenosylcob(III)yrinic acid a,c-diamide
 
−
** Adenosylcobyrinic acid a,c-diamide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[R344-RXN]]
+
** 1 [[3-CYANOPYRIDINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[NIACINAMIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 3-cyanopyridine[c] '''+''' 1 H2O[c] '''=>''' 1 nicotinamide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4032]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[P345-PWY]], aldoxime degradation: [http://metacyc.org/META/NEW-IMAGE?object=P345-PWY P345-PWY]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819815 91819815]
+
{{#set: common name=probable_nitrile_hydratase}}
−
* CHEBI:
+
{{#set: ec number=EC-4.2.1.84}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58503 58503]
+
{{#set: gene associated=Tiso_gene_4032}}
−
* LIGAND-CPD:
+
{{#set: in pathway=P345-PWY}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06506 C06506]
+
{{#set: reconstruction category=annotation}}
−
* HMDB : HMDB01083
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: smiles=CC5(=C%10(C(C)(CCC([O-])=O)C(CC(=O)[O-])C9(C%11(C)(C(C)(CC(N)=O)C(CCC([O-])=O)C1(=[N+]([Co--]3([N+]2(C(=C(C)1)C(C)(CC(N)=O)C(CCC([O-])=O)C=2C=C4(C(C)(C)C(CCC([O-])=O)C(=[N+]34)5)))(CC6(C(C(O)C(O6)N7(C=NC8(=C7N=CN=C8N)))O))N9%10)%11)))))}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=OCNLJCZKGHKJGF-NQYRMHKHSA-H}}
+
−
{{#set: common name=adenosyl-cobyrinate a,c-diamide}}
+
−
{{#set: molecular weight=1182.137    }}
+
−
{{#set: common name=adenosyl-cobyrinic acid a,c-diamide|Adenosyl cobyrinate diamide|Adenosylcob(III)yrinic acid a,c-diamide|Adenosylcobyrinic acid a,c-diamide}}
+
−
{{#set: produced by=R344-RXN}}
+

Revision as of 16:09, 21 March 2018

Reaction R313-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • probable_nitrile_hydratase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • P345-PWY, aldoxime degradation: P345-PWY
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-2722&oldid=32596"