Difference between revisions of "ADCLY-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?ob...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY] ==
* smiles:
+
* taxonomic range:
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
+
 
* common name:
 
* common name:
** 24-methylenecholesterol
+
** L-methionine biosynthesis I
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** L-methionine biosynthesis from L-homoserine
 +
** L-methionine biosynthesis by transsulfuration
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''5''' reactions in the full pathway
* [[RXN-707]]
+
* [[HOMOCYSMET-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_1602]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[HOMOCYSMETB12-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1602]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[O-SUCCHOMOSERLYASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3732]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-15131]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3732]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HOMSUCTRAN-RXN HOMSUCTRAN-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92113 92113]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY]
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781]
+
{{#set: common name=L-methionine biosynthesis I}}
* HMDB : HMDB06849
+
{{#set: common name=L-methionine biosynthesis from L-homoserine|L-methionine biosynthesis by transsulfuration}}
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reaction found=4}}
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}}
+
{{#set: total reaction=5}}
{{#set: common name=24-methylenecholesterol}}
+
{{#set: completion rate=80.0}}
{{#set: molecular weight=398.671    }}
+
{{#set: produced by=RXN-707}}
+

Revision as of 15:09, 21 March 2018

Pathway HOMOSER-METSYN-PWY

  • taxonomic range:
  • common name:
    • L-methionine biosynthesis I
  • Synonym(s):
    • L-methionine biosynthesis from L-homoserine
    • L-methionine biosynthesis by transsulfuration

Reaction(s) found

4 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links