Difference between revisions of "CPD-19169"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMETt2m AMETt2m] == * direction: ** REVERSIBLE * common name: ** S-Adenosyl-L-methionine reversible...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMETt2m AMETt2m] ==
* smiles:
+
* direction:
** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
+
** REVERSIBLE
* inchi key:
+
** InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
+
 
* common name:
 
* common name:
** phytenal
+
** S-Adenosyl-L-methionine reversible transport, mitochondrial
* molecular weight:
+
** 294.52   
+
 
* Synonym(s):
 
* Synonym(s):
** 2E-phytenal
 
** 3,7,11,15-tetramethyl-2E-hexadecenal
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-479]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[S-ADENOSYLMETHIONINE]][m] '''+''' 1.0 [[ADENOSYL-HOMO-CYS]][c] '''<=>''' 1.0 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1.0 [[ADENOSYL-HOMO-CYS]][m]
* [[RXN66-478]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 S-adenosyl-L-methionine[m] '''+''' 1.0 S-adenosyl-L-homocysteine[c] '''<=>''' 1.0 S-adenosyl-L-methionine[c] '''+''' 1.0 S-adenosyl-L-homocysteine[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3756]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_8828]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104010025
+
{{#set: direction=REVERSIBLE}}
* PUBCHEM:
+
{{#set: common name=S-Adenosyl-L-methionine reversible transport, mitochondrial}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9900764 9900764]
+
{{#set: gene associated=Tiso_gene_3756|Tiso_gene_8828}}
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O}}
+
{{#set: in pathway=}}
{{#set: inchi key=InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N}}
+
{{#set: reconstruction category=orthology}}
{{#set: common name=phytenal}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: molecular weight=294.52    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=2E-phytenal|3,7,11,15-tetramethyl-2E-hexadecenal}}
+
{{#set: consumed by=RXN66-479}}
+
{{#set: produced by=RXN66-478}}
+

Revision as of 15:09, 21 March 2018

Reaction AMETt2m

  • direction:
    • REVERSIBLE
  • common name:
    • S-Adenosyl-L-methionine reversible transport, mitochondrial
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links