Difference between revisions of "UMP"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5514 RXN0-5514] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34)))) |
* common name: | * common name: | ||
− | ** | + | ** 6α-hydroxy-castasterone |
− | ** | + | * inchi key: |
− | * | + | ** InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N |
− | ** | + | * molecular weight: |
+ | ** 466.7 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** hydroxydeoxocastasterone | ||
+ | ** 6α-hydroxy-6-deoxocastasterone | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-779]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-778]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15542699 15542699] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20760 20760] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15803 C15803] |
− | + | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}} | |
− | {{#set: | + | {{#set: common name=6α-hydroxy-castasterone}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N}} |
+ | {{#set: molecular weight=466.7 }} | ||
+ | {{#set: common name=hydroxydeoxocastasterone|6α-hydroxy-6-deoxocastasterone}} | ||
+ | {{#set: consumed by=RXN-779}} | ||
+ | {{#set: produced by=RXN-778}} |
Revision as of 16:10, 21 March 2018
Contents
Metabolite CPD-724
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
- common name:
- 6α-hydroxy-castasterone
- inchi key:
- InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N
- molecular weight:
- 466.7
- Synonym(s):
- hydroxydeoxocastasterone
- 6α-hydroxy-6-deoxocastasterone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.