Difference between revisions of "L-methionyl-L-leucyl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) * inchi key...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=G6PI G6PI] == * direction: ** REVERSIBLE * common name: ** Glucose-6-phosphate epimerase * Synonym(...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=G6PI G6PI] ==
−
* smiles:
+
* direction:
−
** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=PUEDDPCUCPRQNY-ZYUZMQFOSA-N
+
 
* common name:
 
* common name:
−
** β-D-ribosylnicotinate
+
** Glucose-6-phosphate epimerase
−
* molecular weight:
+
−
** 255.227   
+
 
* Synonym(s):
 
* Synonym(s):
−
** nicotinic acid riboside
 
−
** ribosylnicotinate
 
−
** nicotinic acid ribose
 
−
** nicotinate riboside
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8443]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ALPHA-GLC-6-P]][c] '''<=>''' 1.0 [[GLC-6-P]][c]
−
* [[RXN-14227]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 &alpha;-D-glucose 6-phosphate[c] '''<=>''' 1.0 &beta;-D-glucose 6-phosphate[c]
−
* [[NRPH]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14633]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_15139]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_17734]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_19480]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05841 C05841]
+
{{#set: common name=Glucose-6-phosphate epimerase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_14633|Tiso_gene_15139|Tiso_gene_17734|Tiso_gene_19480}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58527 58527]
+
{{#set: in pathway=}}
−
* METABOLIGHTS : MTBLC58527
+
{{#set: reconstruction category=orthology}}
−
* PUBCHEM:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161233 161233]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB06809
+
−
{{#set: smiles=C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2))}}
+
−
{{#set: inchi key=InChIKey=PUEDDPCUCPRQNY-ZYUZMQFOSA-N}}
+
−
{{#set: common name=&beta;-D-ribosylnicotinate}}
+
−
{{#set: molecular weight=255.227    }}
+
−
{{#set: common name=nicotinic acid riboside|ribosylnicotinate|nicotinic acid ribose|nicotinate riboside}}
+
−
{{#set: consumed by=RXN-8443}}
+
−
{{#set: produced by=RXN-14227}}
+
−
{{#set: reversible reaction associated=NRPH}}
+

Revision as of 15:11, 21 March 2018

Reaction G6PI

  • direction:
    • REVERSIBLE
  • common name:
    • Glucose-6-phosphate epimerase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 α-D-glucose 6-phosphate[c] <=> 1.0 β-D-glucose 6-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-methionyl-L-leucyl-Protein&oldid=32761"