Difference between revisions of "PWY-6098"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] == * smiles: ** C[N+]1(C2(CCC1CC(=O)C2)) * common name: ** tropinone * inc...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C[N+]1(C2(CCC1CC(=O)C2)) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** tropinone |
| + | * inchi key: | ||
| + | ** InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 140.205 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[TROPINE-DEHYDROGENASE-RXN]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=698003 698003] |
| + | * CAS : 532-24-1 | ||
| + | * NCI: | ||
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=118012 118012] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00783 C00783] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.2789160.html 2789160] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57851 57851] |
| − | + | {{#set: smiles=C[N+]1(C2(CCC1CC(=O)C2))}} | |
| − | {{#set: smiles= | + | {{#set: common name=tropinone}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O}} |
| − | {{#set: | + | {{#set: molecular weight=140.205 }} |
| − | {{#set: molecular weight= | + | {{#set: reversible reaction associated=TROPINE-DEHYDROGENASE-RXN}} |
| − | {{#set: | + | |
Revision as of 15:12, 21 March 2018
Contents
Metabolite TROPINONE
- smiles:
- C[N+]1(C2(CCC1CC(=O)C2))
- common name:
- tropinone
- inchi key:
- InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O
- molecular weight:
- 140.205
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+]1(C2(CCC1CC(=O)C2))" cannot be used as a page name in this wiki.
