Difference between revisions of "Tiso gene 2613"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBULOSE-5P RIBULOSE-5P] == * smiles: ** C(C(C(C(CO)=O)O)O)OP([O-])([O-])=O * inchi key: ** InC...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6470 PWY-6470] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6470 PWY-6470] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** peptidoglycan biosynthesis V (β-lactam resistance) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** penicillin resistance |
− | ** | + | ** β-lactam resistance |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''11''' reactions in the full pathway |
− | + | * [[PWY-6386]] | |
− | * [[ | + | ** 0 associated gene: |
− | * [[ | + | * [[RXN-11347]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_1604]] |
− | * [[ | + | ** 2 reconstruction source(s) associated: |
− | * [ | + | *** [[annotation-in-silico_annotation]] |
− | * [ | + | *** [[orthology-esiliculosus]] |
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=3.4.17.14-RXN 3.4.17.14-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11343 RXN-11343] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11344 RXN-11344] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11345 RXN-11345] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11346 RXN-11346] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11348 RXN-11348] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11349 RXN-11349] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15521 RXN-15521] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-201174}} | |
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: common name=peptidoglycan biosynthesis V (β-lactam resistance)}} | |
− | + | {{#set: common name=penicillin resistance|β-lactam resistance}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=18.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:13, 21 March 2018
Pathway PWY-6470
- taxonomic range:
- common name:
- peptidoglycan biosynthesis V (β-lactam resistance)
- Synonym(s):
- penicillin resistance
- β-lactam resistance
Reaction(s) found
2 reactions found over 11 reactions in the full pathway