Difference between revisions of "Tiso gene 8508"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5441 PWY-5441] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1516-DIHYDROBILIVERDIN 1516-DIHYDROBILIVERDIN] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5441 PWY-5441] ==
* smiles:
+
* taxonomic range:
** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
* inchi key:
+
** InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L
+
 
* common name:
 
* common name:
** 15,16-dihydrobiliverdin
+
** S-methyl-L-methionine cycle
* molecular weight:
+
** 582.655   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** SMM cycle
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[1.3.7.3-RXN]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[MMUM-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_5515]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=METHIONINE-S-METHYLTRANSFERASE-RXN METHIONINE-S-METHYLTRANSFERASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ARACYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243901 25243901]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5441 PWY-5441]
* CHEBI:
+
{{#set: taxonomic range=TAX-3193}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57899 57899]
+
{{#set: common name=S-methyl-L-methionine cycle}}
{{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: common name=SMM cycle}}
{{#set: inchi key=InChIKey=ZQHDSLZHMAUUQK-ZTYGKHTCSA-L}}
+
{{#set: reaction found=1}}
{{#set: common name=15,16-dihydrobiliverdin}}
+
{{#set: total reaction=2}}
{{#set: molecular weight=582.655    }}
+
{{#set: completion rate=50.0}}
{{#set: consumed by=1.3.7.3-RXN}}
+

Revision as of 16:14, 21 March 2018

Pathway PWY-5441

  • taxonomic range:
  • common name:
    • S-methyl-L-methionine cycle
  • Synonym(s):
    • SMM cycle

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links