Difference between revisions of "UTP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * inchi key: ** InChIKey=GFXYTQP...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7088 TAX-70...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654] == |
− | * | + | * taxonomic range: |
− | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7088 TAX-7088] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** ( | + | ** (8E,10E)-dodeca-8,10-dienol biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''6''' reactions found over '''11''' reactions in the full pathway |
− | + | * [[2.3.1.155-RXN]] | |
− | * [[1 | + | ** 0 associated gene: |
− | == Reaction(s) | + | ** 2 reconstruction source(s) associated: |
− | * [[ | + | *** [[annotation-in-silico_annotation]] |
− | * [ | + | *** [[annotation-experimental_annotation]] |
+ | * [[RXN-12507]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_5857]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-14131]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[Tiso_gene_883]] | ||
+ | *** [[Tiso_gene_6475]] | ||
+ | *** [[Tiso_gene_18566]] | ||
+ | *** [[Tiso_gene_16631]] | ||
+ | *** [[Tiso_gene_5991]] | ||
+ | *** [[Tiso_gene_17967]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-14268]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[Tiso_gene_10116]] | ||
+ | *** [[Tiso_gene_3855]] | ||
+ | *** [[Tiso_gene_16181]] | ||
+ | *** [[Tiso_gene_15327]] | ||
+ | *** [[Tiso_gene_17451]] | ||
+ | *** [[Tiso_gene_3856]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-14271]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_5857]] | ||
+ | *** [[Tiso_gene_14262]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-16540]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[Tiso_gene_6475]] | ||
+ | *** [[Tiso_gene_5991]] | ||
+ | *** [[Tiso_gene_16631]] | ||
+ | *** [[Tiso_gene_18566]] | ||
+ | *** [[Tiso_gene_883]] | ||
+ | *** [[Tiso_gene_17967]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14272 RXN-14272] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14273 RXN-14273] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16541 RXN-16541] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16542 RXN-16542] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16543 RXN-16543] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-7088}} | |
− | + | {{#set: common name=(8E,10E)-dodeca-8,10-dienol biosynthesis}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=55.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name=( | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:14, 21 March 2018
Pathway PWY-7654
- taxonomic range:
- common name:
- (8E,10E)-dodeca-8,10-dienol biosynthesis
- Synonym(s):
Reaction(s) found
6 reactions found over 11 reactions in the full pathway
- 2.3.1.155-RXN
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-12507
- 1 associated gene(s):
- 5 reconstruction source(s) associated:
- RXN-14131
- 6 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-14268
- 6 associated gene(s):
- 5 reconstruction source(s) associated:
- RXN-14271
- 2 associated gene(s):
- 5 reconstruction source(s) associated:
- RXN-16540
- 6 associated gene(s):
- 2 reconstruction source(s) associated: