Difference between revisions of "CPD1F-119"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5086 PWY-5086] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-27...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == * smiles: ** CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1) * common name: ** 3-oxo-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-730 CPD-730] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1) |
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate |
| + | * inchi key: | ||
| + | ** InChIKey=BZXZFDKIRZBJEP-CLTKARDFSA-M | ||
| + | * molecular weight: | ||
| + | ** 293.425 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid | ||
| + | ** oxopentenyl-cyclopentane-octanoic acid | ||
| + | ** 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate | ||
| + | ** OPC8 | ||
| + | ** OPC-8:0 | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10695]] | |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
== External links == | == External links == | ||
| − | * | + | * LIPID_MAPS : LMFA02010006 |
| − | ** [http:// | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244083 25244083] |
| − | {{#set: | + | * HMDB : HMDB36217 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49265 49265] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | { | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04780 C04780] |
| − | + | {{#set: smiles=CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1)}} | |
| − | {{#set: | + | {{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate}} |
| + | {{#set: inchi key=InChIKey=BZXZFDKIRZBJEP-CLTKARDFSA-M}} | ||
| + | {{#set: molecular weight=293.425 }} | ||
| + | {{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid|oxopentenyl-cyclopentane-octanoic acid|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate|OPC8|OPC-8:0}} | ||
| + | {{#set: consumed by=RXN-10695}} | ||
Revision as of 15:14, 21 March 2018
Contents
Metabolite CPD-730
- smiles:
- CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1)
- common name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate
- inchi key:
- InChIKey=BZXZFDKIRZBJEP-CLTKARDFSA-M
- molecular weight:
- 293.425
- Synonym(s):
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoic acid
- oxopentenyl-cyclopentane-octanoic acid
- 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate
- OPC8
- OPC-8:0
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC1(C(=O)CCC(CCCCCCCC([O-])=O)1)" cannot be used as a page name in this wiki.
"8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoate" cannot be used as a page name in this wiki.
