Difference between revisions of "RXN-17731"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6693 PWY-6693] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3946 CPD-3946] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6693 PWY-6693] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3946 CPD-3946] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** D-galactose degradation IV
+
** (22S,24R)-22-hydroxy-5α-ergostan-3-one
 +
* inchi key:
 +
** InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N
 +
* molecular weight:
 +
** 416.686   
 
* Synonym(s):
 
* Synonym(s):
 +
** (22S)-22-hydroxy-5α-campestan-3-one
 +
** (22α)-hydroxy-5α-campestan-3-one
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-12078]]
+
* [[RXN-4230]]
−
** 4 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_18748]]
+
−
*** [[Tiso_gene_7799]]
+
−
*** [[Tiso_gene_7800]]
+
−
*** [[Tiso_gene_8988]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12079 RXN-12079]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12080 RXN-12080]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-4751}}
+
* LIPID_MAPS : LMST01031117
−
{{#set: common name=D-galactose degradation IV}}
+
* PUBCHEM:
−
{{#set: reaction found=1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878488 46878488]
−
{{#set: total reaction=3}}
+
* HMDB : HMDB12112
−
{{#set: completion rate=33.0}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59411 59411]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15797 C15797]
 +
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=(22S,24R)-22-hydroxy-5α-ergostan-3-one}}
 +
{{#set: inchi key=InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N}}
 +
{{#set: molecular weight=416.686    }}
 +
{{#set: common name=(22S)-22-hydroxy-5α-campestan-3-one|(22α)-hydroxy-5α-campestan-3-one}}
 +
{{#set: produced by=RXN-4230}}

Revision as of 15:14, 21 March 2018

Metabolite CPD-3946

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • (22S,24R)-22-hydroxy-5α-ergostan-3-one
  • inchi key:
    • InChIKey=XGIZPVUTLMXXTK-VNSZYHACSA-N
  • molecular weight:
    • 416.686
  • Synonym(s):
    • (22S)-22-hydroxy-5α-campestan-3-one
    • (22α)-hydroxy-5α-campestan-3-one

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • LIPID_MAPS : LMST01031117
  • PUBCHEM:
  • HMDB : HMDB12112
  • CHEBI:
  • LIGAND-CPD:
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17731&oldid=33078"