Difference between revisions of "PAPS"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINOLINATE QUINOLINATE] == * smiles: ** C1(=CC=C(C(C([O-])=O)=N1)C([O-])=O) * inchi key: ** In...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5288 PWY-5288] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5288 PWY-5288] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3042 TAX-3042] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
* common name: | * common name: | ||
− | ** | + | ** astaxanthin biosynthesis (bacteria, fungi, algae) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''10''' reactions in the full pathway |
− | == Reaction(s) | + | * [[RXN-8025]] |
− | * [[RXN- | + | ** 1 associated gene(s): |
− | == | + | *** [[Tiso_gene_10837]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-synechocystis]] | ||
+ | * [[RXN-8026]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_10837]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-synechocystis]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8184 RXN-8184] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8185 RXN-8185] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8186 RXN-8186] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8187 RXN-8187] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8189 RXN-8189] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8190 RXN-8190] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8214 RXN-8214] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8215 RXN-8215] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-3042}} | |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: common name=astaxanthin biosynthesis (bacteria, fungi, algae)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=10}} | |
− | + | {{#set: completion rate=20.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:16, 21 March 2018
Pathway PWY-5288
- taxonomic range:
- common name:
- astaxanthin biosynthesis (bacteria, fungi, algae)
- Synonym(s):
Reaction(s) found
2 reactions found over 10 reactions in the full pathway
- RXN-8025
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-8026
- 1 associated gene(s):
- 1 reconstruction source(s) associated: