Difference between revisions of "Tiso gene 12434"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-375 PWY66-375] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-375 PWY66-375] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742]
−
* inchi key:
+
−
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
+
 
* common name:
 
* common name:
−
** cycloartenol
+
** leukotriene biosynthesis
−
* molecular weight:
+
−
** 426.724   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 9β,19-cyclo-24-lanosten-3β-ol
 
−
** cycloart-24(25)-enol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-4021]]
+
'''2''' reactions found over '''6''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
−
* [[CYCLOARTENOL-SYNTHASE-RXN]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_16906]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN66-336]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_12321]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ARACHIDONATE-5-LIPOXYGENASE-RXN ARACHIDONATE-5-LIPOXYGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=LEUKOTRIENE-C4-SYNTHASE-RXN LEUKOTRIENE-C4-SYNTHASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8647 RXN-8647]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN66-337 RXN66-337]
 
== External links  ==
 
== External links  ==
−
* CAS : 469-38-5
+
* REACTOME : 15354
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-7742}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254]
+
{{#set: common name=leukotriene biosynthesis}}
−
* CHEBI:
+
{{#set: reaction found=2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
+
{{#set: total reaction=6}}
−
* LIGAND-CPD:
+
{{#set: completion rate=33.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
+
−
* HMDB : HMDB36591
+
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
−
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
+
−
{{#set: common name=cycloartenol}}
+
−
{{#set: molecular weight=426.724    }}
+
−
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}}
+
−
{{#set: consumed by=RXN-4021}}
+
−
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}
+

Revision as of 15:17, 21 March 2018

Pathway PWY66-375

  • taxonomic range:
  • common name:
    • leukotriene biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links

  • REACTOME : 15354



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12434&oldid=33310"