Difference between revisions of "4-GUANIDO-BUTYRAMIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_13560 == * left end position: ** 3676 * transcription direction: ** POSITIVE * right end position: ** 5777 * centisome position: ** 59.0711...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_13560 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10332 CPD-10332] ==
−
* left end position:
+
* smiles:
−
** 3676
+
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** gibberellin44 (open lactone form)
−
* right end position:
+
* inchi key:
−
** 5777
+
** InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
−
* centisome position:
+
* molecular weight:
−
** 59.07119    
+
** 362.422    
 
* Synonym(s):
 
* Synonym(s):
 +
** gibberellin A44 open lactone
 +
** gibberellin A44 diacid
 +
** GA44 open lactone
 +
** GA44 (open lactone form)
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]]
+
* [[RXN1F-168]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[RXN1F-167]]
−
** experimental_annotation
+
== Reaction(s) of unknown directionality ==
−
***automated-name-match
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3676}}
+
* LIPID_MAPS : LMPR0104170008
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=5777}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243940 25243940]
−
{{#set: centisome position=59.07119   }}
+
* CHEBI:
−
{{#set: reaction associated=METHIONYL-TRNA-FORMYLTRANSFERASE-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27531 27531]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C06095 C06095]
 +
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: common name=gibberellin44 (open lactone form)}}
 +
{{#set: inchi key=InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L}}
 +
{{#set: molecular weight=362.422   }}
 +
{{#set: common name=gibberellin A44 open lactone|gibberellin A44 diacid|GA44 open lactone|GA44 (open lactone form)}}
 +
{{#set: consumed by=RXN1F-168}}
 +
{{#set: produced by=RXN1F-167}}

Revision as of 16:17, 21 March 2018

Metabolite CPD-10332

  • smiles:
    • C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • common name:
    • gibberellin44 (open lactone form)
  • inchi key:
    • InChIKey=AXEUUXHMKSPQAI-YTJHIPEWSA-L
  • molecular weight:
    • 362.422
  • Synonym(s):
    • gibberellin A44 open lactone
    • gibberellin A44 diacid
    • GA44 open lactone
    • GA44 (open lactone form)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=4-GUANIDO-BUTYRAMIDE&oldid=33311"