Difference between revisions of "PWY-735"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Prime-OH-Terminated-RNAs 3Prime-OH-Terminated-RNAs] == * common name: ** an [RNA]-3'-hydroxyl...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Prime-OH-Terminated-RNAs 3Prime-OH-Terminated-RNAs] ==
* smiles:
+
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
* inchi key:
+
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
+
 
* common name:
 
* common name:
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
+
** an [RNA]-3'-hydroxyl
* molecular weight:
+
** 442.724   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a 5'-hydroxyl terminated RNA
 +
** 5'-hydroxy-[RNA]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-13]]
+
* [[RXN-17927]]
 +
* [[RNA-LIGASE-ATP-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-12]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an [RNA]-3'-hydroxyl}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698824 15698824]
+
{{#set: common name=a 5'-hydroxyl terminated RNA|5'-hydroxy-[RNA]}}
* CHEBI:
+
{{#set: consumed by=RXN-17927|RNA-LIGASE-ATP-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87060 87060]
+
* HMDB : HMDB12159
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
+
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=442.724    }}
+
{{#set: consumed by=RXN66-13}}
+
{{#set: produced by=RXN66-12}}
+

Revision as of 15:17, 21 March 2018

Metabolite 3Prime-OH-Terminated-RNAs

  • common name:
    • an [RNA]-3'-hydroxyl
  • Synonym(s):
    • a 5'-hydroxyl terminated RNA
    • 5'-hydroxy-[RNA]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [RNA]-3'-hydroxyl" cannot be used as a page name in this wiki.
"5'-hydroxy-[RNA" cannot be used as a page name in this wiki.