Difference between revisions of "Tiso gene 10338"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-882 PWY-882] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOARTENOL CYCLOARTENOL] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
 
* common name:
 
* common name:
−
** L-ascorbate biosynthesis I (L-galactose pathway)
+
** cycloartenol
 +
* inchi key:
 +
** InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
 +
* molecular weight:
 +
** 426.724   
 
* Synonym(s):
 
* Synonym(s):
−
** vitamin C biosynthesis
+
** 9β,19-cyclo-24-lanosten-3β-ol
−
** ascorbic acid biosynthesis
+
** cycloart-24(25)-enol
−
** L-ascorbic acid biosynthesis I
+
−
** Smirnoff-Wheeler pathway
+
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''6''' reactions found over '''8''' reactions in the full pathway
+
* [[RXN-4021]]
−
* [[2.7.7.13-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 1 associated gene(s):
+
* [[CYCLOARTENOL-SYNTHASE-RXN]]
−
*** [[Tiso_gene_14704]]
+
== Reaction(s) of unknown directionality ==
−
** 1 reconstruction source(s) associated:
+
−
*** [[orthology-synechocystis]]
+
−
* [[GALACTONOLACTONE-DEHYDROGENASE-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_210]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[PHOSMANMUT-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Tiso_gene_5802]]
+
−
*** [[Tiso_gene_13477]]
+
−
*** [[Tiso_gene_4816]]
+
−
*** [[Tiso_gene_14704]]
+
−
** 6 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-synechocystis]]
+
−
*** [[orthology-creinhardtii]]
+
−
* [[RXN-1882]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_6621]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-1884]]
+
−
** 5 associated gene(s):
+
−
*** [[Tiso_gene_14920]]
+
−
*** [[Tiso_gene_14624]]
+
−
*** [[Tiso_gene_18748]]
+
−
*** [[Tiso_gene_703]]
+
−
*** [[Tiso_gene_4219]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXNQT-4142]]
+
−
** 3 associated gene(s):
+
−
*** [[Tiso_gene_10754]]
+
−
*** [[Tiso_gene_15599]]
+
−
*** [[Tiso_gene_11614]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=MANNPISOM-RXN MANNPISOM-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4141 RXNQT-4141]
+
 
== External links  ==
 
== External links  ==
−
* ARACYC:
+
* CAS : 469-38-5
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-882 PWY-882]
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-33090}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44434254 44434254]
−
{{#set: common name=L-ascorbate biosynthesis I (L-galactose pathway)}}
+
* HMDB : HMDB36591
−
{{#set: common name=vitamin C biosynthesis|ascorbic acid biosynthesis|L-ascorbic acid biosynthesis I|Smirnoff-Wheeler pathway}}
+
* CHEBI:
−
{{#set: reaction found=6}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17030 17030]
−
{{#set: total reaction=8}}
+
* LIGAND-CPD:
−
{{#set: completion rate=75.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01902 C01902]
 +
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
 +
{{#set: common name=cycloartenol}}
 +
{{#set: inchi key=InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N}}
 +
{{#set: molecular weight=426.724    }}
 +
{{#set: common name=9β,19-cyclo-24-lanosten-3β-ol|cycloart-24(25)-enol}}
 +
{{#set: consumed by=RXN-4021}}
 +
{{#set: produced by=CYCLOARTENOL-SYNTHASE-RXN}}

Revision as of 15:17, 21 March 2018

Metabolite CYCLOARTENOL

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
  • common name:
    • cycloartenol
  • inchi key:
    • InChIKey=ONQRKEUAIJMULO-COENLIPYSA-N
  • molecular weight:
    • 426.724
  • Synonym(s):
    • 9β,19-cyclo-24-lanosten-3β-ol
    • cycloart-24(25)-enol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10338&oldid=33365"