Difference between revisions of "PWY-6807"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6307 PWY-6307] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-4...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6307 PWY-6307] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8608 CPD-8608] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]
+
** CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
 
* common name:
 
* common name:
−
** L-tryptophan degradation X (mammalian, via tryptamine)
+
** 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
 +
* inchi key:
 +
** InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
 +
* molecular weight:
 +
** 442.724   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN66-13]]
−
* [[RXN-10715]]
+
== Reaction(s) known to produce the compound ==
−
** 2 associated gene(s):
+
* [[RXN66-12]]
−
*** [[Tiso_gene_7322]]
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_3513]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-esiliculosus]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10717 RXN-10717]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1401 RXN-1401]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-40674}}
+
* PUBCHEM:
−
{{#set: common name=L-tryptophan degradation X (mammalian, via tryptamine)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15698824 15698824]
−
{{#set: reaction found=1}}
+
* CHEBI:
−
{{#set: total reaction=4}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87060 87060]
−
{{#set: completion rate=25.0}}
+
* HMDB : HMDB12159
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
 +
{{#set: common name=4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: inchi key=InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N}}
 +
{{#set: molecular weight=442.724    }}
 +
{{#set: consumed by=RXN66-13}}
 +
{{#set: produced by=RXN66-12}}

Revision as of 16:17, 21 March 2018

Metabolite CPD-8608

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
  • common name:
    • 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol
  • inchi key:
    • InChIKey=MKMLAQLNFVFNRK-PUXRVUTHSA-N
  • molecular weight:
    • 442.724
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)(C(C=O)(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6807&oldid=33373"