Difference between revisions of "PWY-5189"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * smiles: ** C(=O)([O-])CC(=N)C(=O)[O-] * inchi key: ** InChI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINYL-ETCETERA-MANNOSYL-R GLUCOSAMINYL-ETCETERA-MANNOSYL-R] == * common name: ** (N-acet...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINYL-ETCETERA-MANNOSYL-R GLUCOSAMINYL-ETCETERA-MANNOSYL-R] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** 2- | + | ** (N-acetyl-β-D-glucosaminyl-1,2)-α-D-mannosyl-1,3-(β-N-acetyl-D-glucosaminyl-1,2-α-D-mannosyl-1,6)-β-D-mannosyl-R |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-7873]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=(N-acetyl-β-D-glucosaminyl-1,2)-α-D-mannosyl-1,3-(β-N-acetyl-D-glucosaminyl-1,2-α-D-mannosyl-1,6)-β-D-mannosyl-R}} | |
| − | + | {{#set: reversible reaction associated=RXN-7873}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Revision as of 15:18, 21 March 2018
Contents
Metabolite GLUCOSAMINYL-ETCETERA-MANNOSYL-R
- common name:
- (N-acetyl-β-D-glucosaminyl-1,2)-α-D-mannosyl-1,3-(β-N-acetyl-D-glucosaminyl-1,2-α-D-mannosyl-1,6)-β-D-mannosyl-R
- Synonym(s):
