Difference between revisions of "Tiso gene 15171"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FUMARYLACETOACETASE-RXN FUMARYLACETOACETASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE] == * smiles: *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(C([O-])=O)C(C([O-])=O)O |
* common name: | * common name: | ||
− | ** | + | ** (2R,3S)-3-isopropylmalate |
− | ** | + | * inchi key: |
− | * | + | ** InChIKey=RNQHMTFBUSSBJQ-CRCLSJGQSA-L |
− | ** | + | * molecular weight: |
+ | ** 174.153 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-D-threo-hydroxy-3-carboxy-isocaproate | ||
+ | ** 3-carboxy-2-hydroxy-4-methylpentanoate | ||
+ | ** β-isopropylmalate | ||
+ | ** 3-isopropylmalate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-13158]] | |
− | + | * [[IMDH]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-8991]] | |
− | = | + | * [[RXN-13163]] |
− | + | * [[3-ISOPROPYLMALDEHYDROG-RXN]] | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857402 6857402] |
− | * LIGAND- | + | * HMDB : HMDB12156 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * LIGAND-CPD: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04411 C04411] |
− | ** [http://www. | + | * CHEMSPIDER: |
− | * | + | ** [http://www.chemspider.com/Chemical-Structure.5256741.html 5256741] |
− | ** [http://www. | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35121 35121] |
− | + | * BIGG : 3c2hmp | |
− | {{#set: common name= | + | {{#set: smiles=CC(C)C(C([O-])=O)C(C([O-])=O)O}} |
− | {{#set: | + | {{#set: common name=(2R,3S)-3-isopropylmalate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=RNQHMTFBUSSBJQ-CRCLSJGQSA-L}} |
− | {{#set: | + | {{#set: molecular weight=174.153 }} |
− | {{#set: | + | {{#set: common name=2-D-threo-hydroxy-3-carboxy-isocaproate|3-carboxy-2-hydroxy-4-methylpentanoate|β-isopropylmalate|3-isopropylmalate}} |
− | {{#set: | + | {{#set: consumed by=RXN-13158|IMDH}} |
− | + | {{#set: reversible reaction associated=RXN-8991|RXN-13163|3-ISOPROPYLMALDEHYDROG-RXN}} |
Revision as of 16:18, 21 March 2018
Contents
Metabolite 2-D-THREO-HYDROXY-3-CARBOXY-ISOCAPROATE
- smiles:
- CC(C)C(C([O-])=O)C(C([O-])=O)O
- common name:
- (2R,3S)-3-isopropylmalate
- inchi key:
- InChIKey=RNQHMTFBUSSBJQ-CRCLSJGQSA-L
- molecular weight:
- 174.153
- Synonym(s):
- 2-D-threo-hydroxy-3-carboxy-isocaproate
- 3-carboxy-2-hydroxy-4-methylpentanoate
- β-isopropylmalate
- 3-isopropylmalate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C([O-])=O)C(C([O-])=O)O" cannot be used as a page name in this wiki.